C17H16N4O3S — CID 69377008
2-[4-(methanesulfonamido)phenyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide (PubChem CID 69377008) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is 2-[4-(methanesulfonamido)phenyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide.
| Compound Name | 2-[4-(methanesulfonamido)phenyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 69377008 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-[4-(methanesulfonamido)phenyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=Cc2c[nH]c3ncccc23)C(N)=O)cc1 |
| InChI | InChI=1S/C17H16N4O3S/c1-25(23,24)21-13-6-4-11(5-7-13)15(16(18)22)9-12-10-20-17-14(12)3-2-8-19-17/h2-10,21H,1H3,(H2,18,22)(H,19,20) |
| InChIKey | OXHJQBIZRUAWSV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|