C19H15N3O2 — CID 18400885
(Z)-2-(1-methylindol-3-yl)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoic acid (PubChem CID 18400885) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is (Z)-2-(1-methylindol-3-yl)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoic acid.
| Compound Name | (Z)-2-(1-methylindol-3-yl)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 18400885 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (Z)-2-(1-methylindol-3-yl)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoic acid |
| SMILES | Cn1cc(/C(=C/c2c[nH]c3ncccc23)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C19H15N3O2/c1-22-11-16(14-5-2-3-7-17(14)22)15(19(23)24)9-12-10-21-18-13(12)6-4-8-20-18/h2-11H,1H3,(H,20,21)(H,23,24)/b15-9- |
| InChIKey | KNUYXKFEUXJKJZ-DHDCSXOGSA-N |
| XLogP | 3.68 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|