C22H22N4O3 — CID 69376620
(Z)-2-phenyl-3-[4-(piperidine-1-carbonylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid (PubChem CID 69376620) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is (Z)-2-phenyl-3-[4-(piperidine-1-carbonylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-phenyl-3-[4-(piperidine-1-carbonylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69376620 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (Z)-2-phenyl-3-[4-(piperidine-1-carbonylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1c[nH]c2nccc(NC(=O)N3CCCCC3)c12)c1ccccc1 |
| InChI | InChI=1S/C22H22N4O3/c27-21(28)17(15-7-3-1-4-8-15)13-16-14-24-20-19(16)18(9-10-23-20)25-22(29)26-11-5-2-6-12-26/h1,3-4,7-10,13-14H,2,5-6,11-12H2,(H,27,28)(H2,23,24,25,29)/b17-13- |
| InChIKey | GKYGMKLNBHKIQM-LGMDPLHJSA-N |
| XLogP | 4.21 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|