C24H21N5O2 — CID 69375949
3-[4-(benzylcarbamoylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide (PubChem CID 69375949) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 3-[4-(benzylcarbamoylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide.
| Compound Name | 3-[4-(benzylcarbamoylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 69375949 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 3-[4-(benzylcarbamoylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide |
| SMILES | NC(=O)C(=Cc1c[nH]c2nccc(NC(=O)NCc3ccccc3)c12)c1ccccc1 |
| InChI | InChI=1S/C24H21N5O2/c25-22(30)19(17-9-5-2-6-10-17)13-18-15-27-23-21(18)20(11-12-26-23)29-24(31)28-14-16-7-3-1-4-8-16/h1-13,15H,14H2,(H2,25,30)(H3,26,27,28,29,31) |
| InChIKey | REHLJBQUQNHMEA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|