C24H19ClN4O2 — CID 69376036
3-[4-[[2-(3-chlorophenyl)acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide (PubChem CID 69376036) has the molecular formula C24H19ClN4O2 and a molecular weight of 430.90 g/mol. Its IUPAC name is 3-[4-[[2-(3-chlorophenyl)acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide.
| Compound Name | 3-[4-[[2-(3-chlorophenyl)acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 69376036 |
| Molecular Formula | C24H19ClN4O2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 3-[4-[[2-(3-chlorophenyl)acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide |
| SMILES | NC(=O)C(=Cc1c[nH]c2nccc(NC(=O)Cc3cccc(Cl)c3)c12)c1ccccc1 |
| InChI | InChI=1S/C24H19ClN4O2/c25-18-8-4-5-15(11-18)12-21(30)29-20-9-10-27-24-22(20)17(14-28-24)13-19(23(26)31)16-6-2-1-3-7-16/h1-11,13-14H,12H2,(H2,26,31)(H2,27,28,29,30) |
| InChIKey | UPIOGBZJAFOHHA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|