C26H29N5O2 — CID 53108476
5-benzamido-N-benzyl-N-ethyl-2-piperazin-1-ylpyridine-3-carboxamide (PubChem CID 53108476) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 5-benzamido-N-benzyl-N-ethyl-2-piperazin-1-ylpyridine-3-carboxamide.
| Compound Name | 5-benzamido-N-benzyl-N-ethyl-2-piperazin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53108476 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 5-benzamido-N-benzyl-N-ethyl-2-piperazin-1-ylpyridine-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)c2ccccc2)cnc1N1CCNCC1 |
| InChI | InChI=1S/C26H29N5O2/c1-2-30(19-20-9-5-3-6-10-20)26(33)23-17-22(29-25(32)21-11-7-4-8-12-21)18-28-24(23)31-15-13-27-14-16-31/h3-12,17-18,27H,2,13-16,19H2,1H3,(H,29,32) |
| InChIKey | AEKFNEYQQJBJAK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |