C26H28ClN5O2 — CID 50828181
N-benzyl-5-[(4-chlorobenzoyl)amino]-N-ethyl-6-piperazin-1-ylpyridine-3-carboxamide (PubChem CID 50828181) has the molecular formula C26H28ClN5O2 and a molecular weight of 478.00 g/mol. Its IUPAC name is N-benzyl-5-[(4-chlorobenzoyl)amino]-N-ethyl-6-piperazin-1-ylpyridine-3-carboxamide.
| Compound Name | N-benzyl-5-[(4-chlorobenzoyl)amino]-N-ethyl-6-piperazin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 50828181 |
| Molecular Formula | C26H28ClN5O2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-benzyl-5-[(4-chlorobenzoyl)amino]-N-ethyl-6-piperazin-1-ylpyridine-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1cnc(N2CCNCC2)c(NC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C26H28ClN5O2/c1-2-31(18-19-6-4-3-5-7-19)26(34)21-16-23(24(29-17-21)32-14-12-28-13-15-32)30-25(33)20-8-10-22(27)11-9-20/h3-11,16-17,28H,2,12-15,18H2,1H3,(H,30,33) |
| InChIKey | NJMPUWRTFGERFQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |