C28H30ClN3O2 — CID 46038514
N-benzyl-2-[4-[(4-chlorobenzoyl)amino]piperidin-1-yl]-N-ethylbenzamide (PubChem CID 46038514) has the molecular formula C28H30ClN3O2 and a molecular weight of 476.02 g/mol. Its IUPAC name is N-benzyl-2-[4-[(4-chlorobenzoyl)amino]piperidin-1-yl]-N-ethylbenzamide.
| Compound Name | N-benzyl-2-[4-[(4-chlorobenzoyl)amino]piperidin-1-yl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 46038514 |
| Molecular Formula | C28H30ClN3O2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | N-benzyl-2-[4-[(4-chlorobenzoyl)amino]piperidin-1-yl]-N-ethylbenzamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1ccccc1N1CCC(NC(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C28H30ClN3O2/c1-2-31(20-21-8-4-3-5-9-21)28(34)25-10-6-7-11-26(25)32-18-16-24(17-19-32)30-27(33)22-12-14-23(29)15-13-22/h3-15,24H,2,16-20H2,1H3,(H,30,33) |
| InChIKey | FRYKRUGTSRRVIJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |