C28H29Cl2N3O2 — CID 42848423
N-[1-[2-[benzyl(ethyl)carbamoyl]phenyl]piperidin-4-yl]-2,4-dichlorobenzamide (PubChem CID 42848423) has the molecular formula C28H29Cl2N3O2 and a molecular weight of 510.47 g/mol. Its IUPAC name is N-[1-[2-[benzyl(ethyl)carbamoyl]phenyl]piperidin-4-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[1-[2-[benzyl(ethyl)carbamoyl]phenyl]piperidin-4-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 42848423 |
| Molecular Formula | C28H29Cl2N3O2 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[1-[2-[benzyl(ethyl)carbamoyl]phenyl]piperidin-4-yl]-2,4-dichlorobenzamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1ccccc1N1CCC(NC(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C28H29Cl2N3O2/c1-2-32(19-20-8-4-3-5-9-20)28(35)24-10-6-7-11-26(24)33-16-14-22(15-17-33)31-27(34)23-13-12-21(29)18-25(23)30/h3-13,18,22H,2,14-17,19H2,1H3,(H,31,34) |
| InChIKey | MAJQOJSIJNNJAP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |