C23H25Cl2N3O2 — CID 42848150
2,4-dichloro-N-[1-[2-(cyclopropylmethylcarbamoyl)phenyl]piperidin-4-yl]benzamide (PubChem CID 42848150) has the molecular formula C23H25Cl2N3O2 and a molecular weight of 446.38 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[2-(cyclopropylmethylcarbamoyl)phenyl]piperidin-4-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[2-(cyclopropylmethylcarbamoyl)phenyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 42848150 |
| Molecular Formula | C23H25Cl2N3O2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2,4-dichloro-N-[1-[2-(cyclopropylmethylcarbamoyl)phenyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(c2ccccc2C(=O)NCC2CC2)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H25Cl2N3O2/c24-16-7-8-18(20(25)13-16)23(30)27-17-9-11-28(12-10-17)21-4-2-1-3-19(21)22(29)26-14-15-5-6-15/h1-4,7-8,13,15,17H,5-6,9-12,14H2,(H,26,29)(H,27,30) |
| InChIKey | BEOYIKRRVYUKGF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |