C25H31ClN4O2 — CID 42847963
2-[4-[(3-chlorobenzoyl)amino]piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 42847963) has the molecular formula C25H31ClN4O2 and a molecular weight of 455.00 g/mol. Its IUPAC name is 2-[4-[(3-chlorobenzoyl)amino]piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 2-[4-[(3-chlorobenzoyl)amino]piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 42847963 |
| Molecular Formula | C25H31ClN4O2 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 2-[4-[(3-chlorobenzoyl)amino]piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | O=C(NC1CCN(c2ccccc2C(=O)NCCN2CCCC2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H31ClN4O2/c26-20-7-5-6-19(18-20)24(31)28-21-10-15-30(16-11-21)23-9-2-1-8-22(23)25(32)27-12-17-29-13-3-4-14-29/h1-2,5-9,18,21H,3-4,10-17H2,(H,27,32)(H,28,31) |
| InChIKey | CHGURDAPGVXNGD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |