C23H36N4O2 — CID 46037280
2-[4-(3-methylbutanoylamino)piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 46037280) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 2-[4-(3-methylbutanoylamino)piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 2-[4-(3-methylbutanoylamino)piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 46037280 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 2-[4-(3-methylbutanoylamino)piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | CC(C)CC(=O)NC1CCN(c2ccccc2C(=O)NCCN2CCCC2)CC1 |
| InChI | InChI=1S/C23H36N4O2/c1-18(2)17-22(28)25-19-9-14-27(15-10-19)21-8-4-3-7-20(21)23(29)24-11-16-26-12-5-6-13-26/h3-4,7-8,18-19H,5-6,9-17H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | VRCUZDGTTWRYOV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |