C23H34N4O2 — CID 42847952
2-[4-(cyclobutanecarbonylamino)piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 42847952) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-[4-(cyclobutanecarbonylamino)piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 2-[4-(cyclobutanecarbonylamino)piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 42847952 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2-[4-(cyclobutanecarbonylamino)piperidin-1-yl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | O=C(NCCN1CCCC1)c1ccccc1N1CCC(NC(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C23H34N4O2/c28-22(18-6-5-7-18)25-19-10-15-27(16-11-19)21-9-2-1-8-20(21)23(29)24-12-17-26-13-3-4-14-26/h1-2,8-9,18-19H,3-7,10-17H2,(H,24,29)(H,25,28) |
| InChIKey | XPMZOTXBJRTFSM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |