C28H30ClN3O3 — CID 46037896
2-[4-[(2-chlorobenzoyl)amino]piperidin-1-yl]-N-[2-(2-methoxyphenyl)ethyl]benzamide (PubChem CID 46037896) has the molecular formula C28H30ClN3O3 and a molecular weight of 492.02 g/mol. Its IUPAC name is 2-[4-[(2-chlorobenzoyl)amino]piperidin-1-yl]-N-[2-(2-methoxyphenyl)ethyl]benzamide.
| Compound Name | 2-[4-[(2-chlorobenzoyl)amino]piperidin-1-yl]-N-[2-(2-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46037896 |
| Molecular Formula | C28H30ClN3O3 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-[4-[(2-chlorobenzoyl)amino]piperidin-1-yl]-N-[2-(2-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccccc1CCNC(=O)c1ccccc1N1CCC(NC(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C28H30ClN3O3/c1-35-26-13-7-2-8-20(26)14-17-30-27(33)23-10-4-6-12-25(23)32-18-15-21(16-19-32)31-28(34)22-9-3-5-11-24(22)29/h2-13,21H,14-19H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | ZVWHKQIOWFXFTI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |