C24H25N3O2 — CID 109105863
5-N-benzyl-3-N-(2,5-dimethylphenyl)-5-N-ethylpyridine-3,5-dicarboxamide (PubChem CID 109105863) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 5-N-benzyl-3-N-(2,5-dimethylphenyl)-5-N-ethylpyridine-3,5-dicarboxamide.
| Compound Name | 5-N-benzyl-3-N-(2,5-dimethylphenyl)-5-N-ethylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109105863 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 5-N-benzyl-3-N-(2,5-dimethylphenyl)-5-N-ethylpyridine-3,5-dicarboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1cncc(C(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C24H25N3O2/c1-4-27(16-19-8-6-5-7-9-19)24(29)21-13-20(14-25-15-21)23(28)26-22-12-17(2)10-11-18(22)3/h5-15H,4,16H2,1-3H3,(H,26,28) |
| InChIKey | SLGOVDHGVVFTHK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |