C22H23N5O2S — CID 50828335
N-phenyl-6-piperazin-1-yl-5-[(2-thiophen-2-ylacetyl)amino]pyridine-3-carboxamide (PubChem CID 50828335) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is N-phenyl-6-piperazin-1-yl-5-[(2-thiophen-2-ylacetyl)amino]pyridine-3-carboxamide.
| Compound Name | N-phenyl-6-piperazin-1-yl-5-[(2-thiophen-2-ylacetyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 50828335 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-phenyl-6-piperazin-1-yl-5-[(2-thiophen-2-ylacetyl)amino]pyridine-3-carboxamide |
| SMILES | O=C(Cc1cccs1)Nc1cc(C(=O)Nc2ccccc2)cnc1N1CCNCC1 |
| InChI | InChI=1S/C22H23N5O2S/c28-20(14-18-7-4-12-30-18)26-19-13-16(22(29)25-17-5-2-1-3-6-17)15-24-21(19)27-10-8-23-9-11-27/h1-7,12-13,15,23H,8-11,14H2,(H,25,29)(H,26,28) |
| InChIKey | OLKWDZFIRHTMAX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |