C20H22N4O3S — CID 50792075
N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)-2-thiophen-2-ylacetamide (PubChem CID 50792075) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 50792075 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)-2-thiophen-2-ylacetamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(N3CCCC3)c(NC(=O)Cc3cccs3)cc21 |
| InChI | InChI=1S/C20H22N4O3S/c1-22-16-11-14(21-18(25)10-13-6-5-9-28-13)15(24-7-3-4-8-24)12-17(16)23(2)20(27)19(22)26/h5-6,9,11-12H,3-4,7-8,10H2,1-2H3,(H,21,25) |
| InChIKey | VDTZHQRQJJSERW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|