C22H31N5O3 — CID 18525283
N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)-2-(4-methylpiperidin-1-yl)acetamide (PubChem CID 18525283) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)-2-(4-methylpiperidin-1-yl)acetamide.
| Compound Name | N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)-2-(4-methylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 18525283 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)-2-(4-methylpiperidin-1-yl)acetamide |
| SMILES | CC1CCN(CC(=O)Nc2cc3c(cc2N2CCCC2)n(C)c(=O)c(=O)n3C)CC1 |
| InChI | InChI=1S/C22H31N5O3/c1-15-6-10-26(11-7-15)14-20(28)23-16-12-18-19(13-17(16)27-8-4-5-9-27)25(3)22(30)21(29)24(18)2/h12-13,15H,4-11,14H2,1-3H3,(H,23,28) |
| InChIKey | JGLCXEBYGRPQJA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|