C11H14BN2 — CID 89301473
CID 89301473 (PubChem CID 89301473) has the molecular formula C11H14BN2 and a molecular weight of 185.06 g/mol.
| Compound Name | CID 89301473 |
|---|---|
| PubChem CID | 89301473 |
| Molecular Formula | C11H14BN2 |
| Molecular Weight | 185.06 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | — |
| SMILES | C[B]CCCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C11H14BN2/c1-12-6-2-4-9-8-14-11-10(9)5-3-7-13-11/h3,5,7-8H,2,4,6H2,1H3,(H,13,14) |
| InChIKey | VUTJSIWVRYOOAJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.06 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|