C13H17N3 — CID 174571126
(3R)-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pentan-2-imine (PubChem CID 174571126) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is (3R)-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pentan-2-imine.
| Compound Name | (3R)-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pentan-2-imine |
|---|---|
| PubChem CID | 174571126 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (3R)-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pentan-2-imine |
| SMILES | [H]/N=C(\C)[C@H](CC)Cc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C13H17N3/c1-3-10(9(2)14)7-11-8-16-13-12(11)5-4-6-15-13/h4-6,8,10,14H,3,7H2,1-2H3,(H,15,16)/b14-9+/t10-/m1/s1 |
| InChIKey | CPDRPIJAIGWEQU-GMROUXNLSA-N |
| XLogP | 3.17 |
| TPSA | 52.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|