C12H17N3O — CID 104980429
(2S)-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)butan-1-ol (PubChem CID 104980429) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is (2S)-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)butan-1-ol.
| Compound Name | (2S)-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)butan-1-ol |
|---|---|
| PubChem CID | 104980429 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (2S)-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)butan-1-ol |
| SMILES | CC[C@@H](CO)NCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C12H17N3O/c1-2-10(8-16)14-6-9-7-15-12-11(9)4-3-5-13-12/h3-5,7,10,14,16H,2,6,8H2,1H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | PSGNZVZCEKIENL-JTQLQIEISA-N |
| XLogP | 1.42 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |