C16H17N3O2 — CID 66414633
2,5-dimethoxy-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline (PubChem CID 66414633) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline.
| Compound Name | 2,5-dimethoxy-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 66414633 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2,5-dimethoxy-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)aniline |
| SMILES | COc1ccc(OC)c(NCc2c[nH]c3ncccc23)c1 |
| InChI | InChI=1S/C16H17N3O2/c1-20-12-5-6-15(21-2)14(8-12)18-9-11-10-19-16-13(11)4-3-7-17-16/h3-8,10,18H,9H2,1-2H3,(H,17,19) |
| InChIKey | RUYOLBFBTICHGT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |