C16H23N3O2 — CID 68722559
N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-2,5-dimethoxyaniline (PubChem CID 68722559) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-2,5-dimethoxyaniline.
| Compound Name | N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 68722559 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-2,5-dimethoxyaniline |
| SMILES | COc1ccc(OC)c(NCc2cn[nH]c2C(C)(C)C)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-16(2,3)15-11(10-18-19-15)9-17-13-8-12(20-4)6-7-14(13)21-5/h6-8,10,17H,9H2,1-5H3,(H,18,19) |
| InChIKey | KWCUUSASAIKXJV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |