C15H16BrNO2 — CID 23767629
N-[(2-bromophenyl)methyl]-2,5-dimethoxyaniline (PubChem CID 23767629) has the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2,5-dimethoxyaniline.
| Compound Name | N-[(2-bromophenyl)methyl]-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 23767629 |
| Molecular Formula | C15H16BrNO2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2,5-dimethoxyaniline |
| SMILES | COc1ccc(OC)c(NCc2ccccc2Br)c1 |
| InChI | InChI=1S/C15H16BrNO2/c1-18-12-7-8-15(19-2)14(9-12)17-10-11-5-3-4-6-13(11)16/h3-9,17H,10H2,1-2H3 |
| InChIKey | FYIZJNYELDIVPN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |