C15H15ClN4O2 — CID 176729390
4-chloro-8-[(2,4-dimethoxyphenyl)methyl]-5H-pteridine (PubChem CID 176729390) has the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. Its IUPAC name is 4-chloro-8-[(2,4-dimethoxyphenyl)methyl]-5H-pteridine.
| Compound Name | 4-chloro-8-[(2,4-dimethoxyphenyl)methyl]-5H-pteridine |
|---|---|
| PubChem CID | 176729390 |
| Molecular Formula | C15H15ClN4O2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-chloro-8-[(2,4-dimethoxyphenyl)methyl]-5H-pteridine |
| SMILES | COc1ccc(CN2C=CNc3c(Cl)ncnc32)c(OC)c1 |
| InChI | InChI=1S/C15H15ClN4O2/c1-21-11-4-3-10(12(7-11)22-2)8-20-6-5-17-13-14(16)18-9-19-15(13)20/h3-7,9,17H,8H2,1-2H3 |
| InChIKey | YVRAALMHTLXGRH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |