C26H24Cl4N2O9 — CID 159124791
3,4-dichloro-1-[(2,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione;3,4-dichlorofuran-2,5-dione;(2,4-dimethoxyphenyl)methanamine (PubChem CID 159124791) has the molecular formula C26H24Cl4N2O9 and a molecular weight of 650.30 g/mol. Its IUPAC name is 3,4-dichloro-1-[(2,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione;3,4-dichlorofuran-2,5-dione;(2,4-dimethoxyphenyl)methanamine.
| Compound Name | 3,4-dichloro-1-[(2,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione;3,4-dichlorofuran-2,5-dione;(2,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 159124791 |
| Molecular Formula | C26H24Cl4N2O9 |
| Molecular Weight | 650.30 g/mol |
| Exact Mass | 648.02 |
| IUPAC Name | 3,4-dichloro-1-[(2,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione;3,4-dichlorofuran-2,5-dione;(2,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(CN)c(OC)c1.COc1ccc(CN2C(=O)C(Cl)=C(Cl)C2=O)c(OC)c1.O=C1OC(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C13H11Cl2NO4.C9H13NO2.C4Cl2O3/c1-19-8-4-3-7(9(5-8)20-2)6-16-12(17)10(14)11(15)13(16)18;1-11-8-4-3-7(6-10)9(5-8)12-2;5-1-2(6)4(8)9-3(1)7/h3-5H,6H2,1-2H3;3-5H,6,10H2,1-2H3; |
| InChIKey | KGDKXXLHKWRUTE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|