C19H24N2O4S — CID 158968323
(2,4-dimethoxyphenyl)methanamine;1-(isothiocyanatomethyl)-2,4-dimethoxybenzene (PubChem CID 158968323) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methanamine;1-(isothiocyanatomethyl)-2,4-dimethoxybenzene.
| Compound Name | (2,4-dimethoxyphenyl)methanamine;1-(isothiocyanatomethyl)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 158968323 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (2,4-dimethoxyphenyl)methanamine;1-(isothiocyanatomethyl)-2,4-dimethoxybenzene |
| SMILES | COc1ccc(CN)c(OC)c1.COc1ccc(CN=C=S)c(OC)c1 |
| InChI | InChI=1S/C10H11NO2S.C9H13NO2/c1-12-9-4-3-8(6-11-7-14)10(5-9)13-2;1-11-8-4-3-7(6-10)9(5-8)12-2/h3-5H,6H2,1-2H3;3-5H,6,10H2,1-2H3 |
| InChIKey | JNMJXYMRJIUBRY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|