C18H24N2O2S — CID 158339606
1-(isothiocyanatomethyl)-2-methoxybenzene;methane;(2-methoxyphenyl)methanamine (PubChem CID 158339606) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-(isothiocyanatomethyl)-2-methoxybenzene;methane;(2-methoxyphenyl)methanamine.
| Compound Name | 1-(isothiocyanatomethyl)-2-methoxybenzene;methane;(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 158339606 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-(isothiocyanatomethyl)-2-methoxybenzene;methane;(2-methoxyphenyl)methanamine |
| SMILES | C.COc1ccccc1CN.COc1ccccc1CN=C=S |
| InChI | InChI=1S/C9H9NOS.C8H11NO.CH4/c1-11-9-5-3-2-4-8(9)6-10-7-12;1-10-8-5-3-2-4-7(8)6-9;/h2-5H,6H2,1H3;2-5H,6,9H2,1H3;1H4 |
| InChIKey | GQZOKKCEOACWCH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|