C29H29N3O7 — CID 158410319
1,3-bis[(2-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione;1-(isocyanatomethyl)-2-methoxybenzene (PubChem CID 158410319) has the molecular formula C29H29N3O7 and a molecular weight of 531.57 g/mol. Its IUPAC name is 1,3-bis[(2-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione;1-(isocyanatomethyl)-2-methoxybenzene.
| Compound Name | 1,3-bis[(2-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione;1-(isocyanatomethyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 158410319 |
| Molecular Formula | C29H29N3O7 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 1,3-bis[(2-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione;1-(isocyanatomethyl)-2-methoxybenzene |
| SMILES | COc1ccccc1CN1C(=O)CC(=O)N(Cc2ccccc2OC)C1=O.COc1ccccc1CN=C=O |
| InChI | InChI=1S/C20H20N2O5.C9H9NO2/c1-26-16-9-5-3-7-14(16)12-21-18(23)11-19(24)22(20(21)25)13-15-8-4-6-10-17(15)27-2;1-12-9-5-3-2-4-8(9)6-10-7-11/h3-10H,11-13H2,1-2H3;2-5H,6H2,1H3 |
| InChIKey | GZFNBRWKVKXJQF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 114.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|