C7H4F3N3O — CID 151573633
3-(trifluoromethyl)-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 151573633) has the molecular formula C7H4F3N3O and a molecular weight of 203.12 g/mol. Its IUPAC name is 3-(trifluoromethyl)-1H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 3-(trifluoromethyl)-1H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 151573633 |
| Molecular Formula | C7H4F3N3O |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 3-(trifluoromethyl)-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | O=c1[nH]c2cccnc2n1C(F)(F)F |
| InChI | InChI=1S/C7H4F3N3O/c8-7(9,10)13-5-4(12-6(13)14)2-1-3-11-5/h1-3H,(H,12,14) |
| InChIKey | QEZCOIBMWQUHSV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |