C9H8ClN3O2 — CID 168900207
7-chloro-3-ethyl-1H-pyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 168900207) has the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. Its IUPAC name is 7-chloro-3-ethyl-1H-pyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 7-chloro-3-ethyl-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 168900207 |
| Molecular Formula | C9H8ClN3O2 |
| Molecular Weight | 225.63 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 7-chloro-3-ethyl-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)[nH]c2cc(Cl)ncc2c1=O |
| InChI | InChI=1S/C9H8ClN3O2/c1-2-13-8(14)5-4-11-7(10)3-6(5)12-9(13)15/h3-4H,2H2,1H3,(H,12,15) |
| InChIKey | CQVVEMUKSINSNV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.63 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|