C17H16N4O4 — CID 154749732
1-pyrazin-2-ylethyl 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylate (PubChem CID 154749732) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 1-pyrazin-2-ylethyl 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylate.
| Compound Name | 1-pyrazin-2-ylethyl 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 154749732 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-pyrazin-2-ylethyl 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylate |
| SMILES | CCn1c(=O)[nH]c2cc(C(=O)OC(C)c3cnccn3)ccc2c1=O |
| InChI | InChI=1S/C17H16N4O4/c1-3-21-15(22)12-5-4-11(8-13(12)20-17(21)24)16(23)25-10(2)14-9-18-6-7-19-14/h4-10H,3H2,1-2H3,(H,20,24) |
| InChIKey | BEVPUCZBNWUYPY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |