C20H21N5O3 — CID 120729563
3-ethyl-7-(2-pyridin-3-ylpiperazine-1-carbonyl)-1H-quinazoline-2,4-dione (PubChem CID 120729563) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-ethyl-7-(2-pyridin-3-ylpiperazine-1-carbonyl)-1H-quinazoline-2,4-dione.
| Compound Name | 3-ethyl-7-(2-pyridin-3-ylpiperazine-1-carbonyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 120729563 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-ethyl-7-(2-pyridin-3-ylpiperazine-1-carbonyl)-1H-quinazoline-2,4-dione |
| SMILES | CCn1c(=O)[nH]c2cc(C(=O)N3CCNCC3c3cccnc3)ccc2c1=O |
| InChI | InChI=1S/C20H21N5O3/c1-2-24-19(27)15-6-5-13(10-16(15)23-20(24)28)18(26)25-9-8-22-12-17(25)14-4-3-7-21-11-14/h3-7,10-11,17,22H,2,8-9,12H2,1H3,(H,23,28) |
| InChIKey | DDMBCFFYLCQKNU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |