C12H13N3O4S — CID 118658724
3-ethyl-1-(methylsulfanylmethyl)-6-nitroquinazoline-2,4-dione (PubChem CID 118658724) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-ethyl-1-(methylsulfanylmethyl)-6-nitroquinazoline-2,4-dione.
| Compound Name | 3-ethyl-1-(methylsulfanylmethyl)-6-nitroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 118658724 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-ethyl-1-(methylsulfanylmethyl)-6-nitroquinazoline-2,4-dione |
| SMILES | CCn1c(=O)c2cc([N+](=O)[O-])ccc2n(CSC)c1=O |
| InChI | InChI=1S/C12H13N3O4S/c1-3-13-11(16)9-6-8(15(18)19)4-5-10(9)14(7-20-2)12(13)17/h4-6H,3,7H2,1-2H3 |
| InChIKey | OSNJRRRREZTEFX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|