C13H14N2O5 — CID 21217745
1-ethyl-3,4-dimethoxy-7-nitroquinolin-2-one (PubChem CID 21217745) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 1-ethyl-3,4-dimethoxy-7-nitroquinolin-2-one.
| Compound Name | 1-ethyl-3,4-dimethoxy-7-nitroquinolin-2-one |
|---|---|
| PubChem CID | 21217745 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-ethyl-3,4-dimethoxy-7-nitroquinolin-2-one |
| SMILES | CCn1c(=O)c(OC)c(OC)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C13H14N2O5/c1-4-14-10-7-8(15(17)18)5-6-9(10)11(19-2)12(20-3)13(14)16/h5-7H,4H2,1-3H3 |
| InChIKey | FTCMIPNIPPRFSE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|