C18H16N4O7 — CID 168952922
3-(2-methoxyethyl)-6-nitro-1-[(4-nitrophenyl)methyl]quinazoline-2,4-dione (PubChem CID 168952922) has the molecular formula C18H16N4O7 and a molecular weight of 400.35 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-6-nitro-1-[(4-nitrophenyl)methyl]quinazoline-2,4-dione.
| Compound Name | 3-(2-methoxyethyl)-6-nitro-1-[(4-nitrophenyl)methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 168952922 |
| Molecular Formula | C18H16N4O7 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 3-(2-methoxyethyl)-6-nitro-1-[(4-nitrophenyl)methyl]quinazoline-2,4-dione |
| SMILES | COCCn1c(=O)c2cc([N+](=O)[O-])ccc2n(Cc2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C18H16N4O7/c1-29-9-8-19-17(23)15-10-14(22(27)28)6-7-16(15)20(18(19)24)11-12-2-4-13(5-3-12)21(25)26/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | SPGZXQRSBVTDJI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 139.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|