C23H20N4O5 — CID 139750402
1-[(4-nitrophenyl)methyl]-3-(2-phenylmethoxyethyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 139750402) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)methyl]-3-(2-phenylmethoxyethyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[(4-nitrophenyl)methyl]-3-(2-phenylmethoxyethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139750402 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-[(4-nitrophenyl)methyl]-3-(2-phenylmethoxyethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1c2cccnc2n(Cc2ccc([N+](=O)[O-])cc2)c(=O)n1CCOCc1ccccc1 |
| InChI | InChI=1S/C23H20N4O5/c28-22-20-7-4-12-24-21(20)26(15-17-8-10-19(11-9-17)27(30)31)23(29)25(22)13-14-32-16-18-5-2-1-3-6-18/h1-12H,13-16H2 |
| InChIKey | QHMMQZJDXCXAHP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 109.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|