C18H13N5O3 — CID 139932468
3-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)imidazo[4,5-b]pyridin-2-one (PubChem CID 139932468) has the molecular formula C18H13N5O3 and a molecular weight of 347.33 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)imidazo[4,5-b]pyridin-2-one.
| Compound Name | 3-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 139932468 |
| Molecular Formula | C18H13N5O3 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)imidazo[4,5-b]pyridin-2-one |
| SMILES | O=c1n(Cc2ccncc2)c2cccnc2n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H13N5O3/c24-18-21(12-13-7-10-19-11-8-13)16-2-1-9-20-17(16)22(18)14-3-5-15(6-4-14)23(25)26/h1-11H,12H2 |
| InChIKey | JHFMDJCZPWGCSC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 95.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|