C24H23N5O4 — CID 139932436
N,2-dimethyl-N-[4-[[3-(3-nitrophenyl)-2-oxoimidazo[4,5-b]pyridin-1-yl]methyl]phenyl]propanamide (PubChem CID 139932436) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is N,2-dimethyl-N-[4-[[3-(3-nitrophenyl)-2-oxoimidazo[4,5-b]pyridin-1-yl]methyl]phenyl]propanamide.
| Compound Name | N,2-dimethyl-N-[4-[[3-(3-nitrophenyl)-2-oxoimidazo[4,5-b]pyridin-1-yl]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 139932436 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N,2-dimethyl-N-[4-[[3-(3-nitrophenyl)-2-oxoimidazo[4,5-b]pyridin-1-yl]methyl]phenyl]propanamide |
| SMILES | CC(C)C(=O)N(C)c1ccc(Cn2c(=O)n(-c3cccc([N+](=O)[O-])c3)c3ncccc32)cc1 |
| InChI | InChI=1S/C24H23N5O4/c1-16(2)23(30)26(3)18-11-9-17(10-12-18)15-27-21-8-5-13-25-22(21)28(24(27)31)19-6-4-7-20(14-19)29(32)33/h4-14,16H,15H2,1-3H3 |
| InChIKey | NCVYAYAPDQVUIW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 103.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|