C20H14N4O3 — CID 22724113
2-benzyl-4-(3-nitrophenyl)pyrido[2,3-b]pyrazin-3-one (PubChem CID 22724113) has the molecular formula C20H14N4O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 2-benzyl-4-(3-nitrophenyl)pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 2-benzyl-4-(3-nitrophenyl)pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 22724113 |
| Molecular Formula | C20H14N4O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-benzyl-4-(3-nitrophenyl)pyrido[2,3-b]pyrazin-3-one |
| SMILES | O=c1c(Cc2ccccc2)nc2cccnc2n1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14N4O3/c25-20-18(12-14-6-2-1-3-7-14)22-17-10-5-11-21-19(17)23(20)15-8-4-9-16(13-15)24(26)27/h1-11,13H,12H2 |
| InChIKey | FOHLKAXBZOFGDJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|