C22H18N4O3 — CID 18002620
1-(3-nitrophenyl)-3-(3-pyridin-2-ylpropyl)-1,8-naphthyridin-2-one (PubChem CID 18002620) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-3-(3-pyridin-2-ylpropyl)-1,8-naphthyridin-2-one.
| Compound Name | 1-(3-nitrophenyl)-3-(3-pyridin-2-ylpropyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 18002620 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-(3-nitrophenyl)-3-(3-pyridin-2-ylpropyl)-1,8-naphthyridin-2-one |
| SMILES | O=c1c(CCCc2ccccn2)cc2cccnc2n1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H18N4O3/c27-22-17(6-3-9-18-8-1-2-12-23-18)14-16-7-5-13-24-21(16)25(22)19-10-4-11-20(15-19)26(28)29/h1-2,4-5,7-8,10-15H,3,6,9H2 |
| InChIKey | YYUHRNLBBAMSKD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|