C22H10N4O8 — CID 635208
2,6-bis(3-nitrophenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 635208) has the molecular formula C22H10N4O8 and a molecular weight of 458.34 g/mol. Its IUPAC name is 2,6-bis(3-nitrophenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(3-nitrophenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 635208 |
| Molecular Formula | C22H10N4O8 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 2,6-bis(3-nitrophenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1c2cc3c(=O)n(-c4cccc([N+](=O)[O-])c4)c(=O)c3cc2c(=O)n1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H10N4O8/c27-19-15-9-17-18(22(30)24(21(17)29)12-4-2-6-14(8-12)26(33)34)10-16(15)20(28)23(19)11-3-1-5-13(7-11)25(31)32/h1-10H |
| InChIKey | HUWPVFBZOYDPCF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 164.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|