C11H9N3O5 — CID 112599075
6-hydroxy-5-methyl-1-(3-nitrophenyl)pyrimidine-2,4-dione (PubChem CID 112599075) has the molecular formula C11H9N3O5 and a molecular weight of 263.21 g/mol. Its IUPAC name is 6-hydroxy-5-methyl-1-(3-nitrophenyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-methyl-1-(3-nitrophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112599075 |
| Molecular Formula | C11H9N3O5 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 6-hydroxy-5-methyl-1-(3-nitrophenyl)pyrimidine-2,4-dione |
| SMILES | Cc1c(O)n(-c2cccc([N+](=O)[O-])c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H9N3O5/c1-6-9(15)12-11(17)13(10(6)16)7-3-2-4-8(5-7)14(18)19/h2-5,16H,1H3,(H,12,15,17) |
| InChIKey | SCMOZXZPYOSVIZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|