C17H9N5O6 — CID 3125059
7-nitro-10-(3-nitrophenyl)pyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 3125059) has the molecular formula C17H9N5O6 and a molecular weight of 379.29 g/mol. Its IUPAC name is 7-nitro-10-(3-nitrophenyl)pyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 7-nitro-10-(3-nitrophenyl)pyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 3125059 |
| Molecular Formula | C17H9N5O6 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 7-nitro-10-(3-nitrophenyl)pyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | O=c1nc2n(-c3cccc([N+](=O)[O-])c3)c3ccc([N+](=O)[O-])cc3cc-2c(=O)[nH]1 |
| InChI | InChI=1S/C17H9N5O6/c23-16-13-7-9-6-12(22(27)28)4-5-14(9)20(15(13)18-17(24)19-16)10-2-1-3-11(8-10)21(25)26/h1-8H,(H,19,23,24) |
| InChIKey | IICDUSHDTASIMA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|