C14H9ClN4O3 — CID 142304219
2-chloro-5-methyl-8-(3-nitrophenyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 142304219) has the molecular formula C14H9ClN4O3 and a molecular weight of 316.70 g/mol. Its IUPAC name is 2-chloro-5-methyl-8-(3-nitrophenyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-chloro-5-methyl-8-(3-nitrophenyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 142304219 |
| Molecular Formula | C14H9ClN4O3 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2-chloro-5-methyl-8-(3-nitrophenyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n(-c2cccc([N+](=O)[O-])c2)c2nc(Cl)ncc12 |
| InChI | InChI=1S/C14H9ClN4O3/c1-8-5-12(20)18(13-11(8)7-16-14(15)17-13)9-3-2-4-10(6-9)19(21)22/h2-7H,1H3 |
| InChIKey | RHTFSUQSCBCCGB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|