C31H38N8O5 — CID 142304220
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[5-methyl-8-(3-nitrophenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]phenyl]prop-2-enamide;ethane (PubChem CID 142304220) has the molecular formula C31H38N8O5 and a molecular weight of 602.70 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[5-methyl-8-(3-nitrophenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]phenyl]prop-2-enamide;ethane.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[5-methyl-8-(3-nitrophenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]phenyl]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 142304220 |
| Molecular Formula | C31H38N8O5 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[5-methyl-8-(3-nitrophenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]phenyl]prop-2-enamide;ethane |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc3c(C)cc(=O)n(-c4cccc([N+](=O)[O-])c4)c3n2)c(OC)cc1N(C)CCN(C)C.CC |
| InChI | InChI=1S/C29H32N8O5.C2H6/c1-7-26(38)31-22-15-23(25(42-6)16-24(22)35(5)12-11-34(3)4)32-29-30-17-21-18(2)13-27(39)36(28(21)33-29)19-9-8-10-20(14-19)37(40)41;1-2/h7-10,13-17H,1,11-12H2,2-6H3,(H,31,38)(H,30,32,33);1-2H3 |
| InChIKey | OMCUKANXOFYFDW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|