C29H31ClN6O2 — CID 122474439
N-[5-[[8-(3-chlorophenyl)quinazolin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 122474439) has the molecular formula C29H31ClN6O2 and a molecular weight of 531.06 g/mol. Its IUPAC name is N-[5-[[8-(3-chlorophenyl)quinazolin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[8-(3-chlorophenyl)quinazolin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122474439 |
| Molecular Formula | C29H31ClN6O2 |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | N-[5-[[8-(3-chlorophenyl)quinazolin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc3cccc(-c4cccc(Cl)c4)c3n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C29H31ClN6O2/c1-6-27(37)32-23-16-24(26(38-5)17-25(23)36(4)14-13-35(2)3)33-29-31-18-20-10-8-12-22(28(20)34-29)19-9-7-11-21(30)15-19/h6-12,15-18H,1,13-14H2,2-5H3,(H,32,37)(H,31,33,34) |
| InChIKey | ANTQNGSBKRNQQV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|