C27H27ClN6O3 — CID 122475015
N-[5-[[8-(5-chloro-3-pyridinyl)quinazolin-2-yl]amino]-2-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide (PubChem CID 122475015) has the molecular formula C27H27ClN6O3 and a molecular weight of 519.01 g/mol. Its IUPAC name is N-[5-[[8-(5-chloro-3-pyridinyl)quinazolin-2-yl]amino]-2-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[8-(5-chloro-3-pyridinyl)quinazolin-2-yl]amino]-2-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122475015 |
| Molecular Formula | C27H27ClN6O3 |
| Molecular Weight | 519.01 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[5-[[8-(5-chloro-3-pyridinyl)quinazolin-2-yl]amino]-2-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc3cccc(-c4cncc(Cl)c4)c3n2)c(OC)cc1OCCN(C)C |
| InChI | InChI=1S/C27H27ClN6O3/c1-5-25(35)31-22-12-21(23(36-4)13-24(22)37-10-9-34(2)3)32-27-30-15-17-7-6-8-20(26(17)33-27)18-11-19(28)16-29-14-18/h5-8,11-16H,1,9-10H2,2-4H3,(H,31,35)(H,30,32,33) |
| InChIKey | GDCZSAUTRDUGML-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.01 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|