C27H28FN7O — CID 122474436
N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-(5-fluoro-3-pyridinyl)quinazolin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 122474436) has the molecular formula C27H28FN7O and a molecular weight of 485.57 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-(5-fluoro-3-pyridinyl)quinazolin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-(5-fluoro-3-pyridinyl)quinazolin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122474436 |
| Molecular Formula | C27H28FN7O |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-(5-fluoro-3-pyridinyl)quinazolin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc3cccc(-c4cncc(F)c4)c3n2)ccc1N(C)CCN(C)C |
| InChI | InChI=1S/C27H28FN7O/c1-5-25(36)32-23-14-21(9-10-24(23)35(4)12-11-34(2)3)31-27-30-16-18-7-6-8-22(26(18)33-27)19-13-20(28)17-29-15-19/h5-10,13-17H,1,11-12H2,2-4H3,(H,32,36)(H,30,31,33) |
| InChIKey | MOFYJDWOMQMESD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|