C31H37FN8O2 — CID 177379831
6-[2-[4-[2-(dimethylamino)ethyl-methylamino]-3-(prop-2-enoylamino)anilino]-5-fluoropyrimidin-4-yl]-N-methyl-1-propan-2-ylindole-2-carboxamide (PubChem CID 177379831) has the molecular formula C31H37FN8O2 and a molecular weight of 572.69 g/mol. Its IUPAC name is 6-[2-[4-[2-(dimethylamino)ethyl-methylamino]-3-(prop-2-enoylamino)anilino]-5-fluoropyrimidin-4-yl]-N-methyl-1-propan-2-ylindole-2-carboxamide.
| Compound Name | 6-[2-[4-[2-(dimethylamino)ethyl-methylamino]-3-(prop-2-enoylamino)anilino]-5-fluoropyrimidin-4-yl]-N-methyl-1-propan-2-ylindole-2-carboxamide |
|---|---|
| PubChem CID | 177379831 |
| Molecular Formula | C31H37FN8O2 |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | 6-[2-[4-[2-(dimethylamino)ethyl-methylamino]-3-(prop-2-enoylamino)anilino]-5-fluoropyrimidin-4-yl]-N-methyl-1-propan-2-ylindole-2-carboxamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(F)c(-c3ccc4cc(C(=O)NC)n(C(C)C)c4c3)n2)ccc1N(C)CCN(C)C |
| InChI | InChI=1S/C31H37FN8O2/c1-8-28(41)36-24-17-22(11-12-25(24)39(7)14-13-38(5)6)35-31-34-18-23(32)29(37-31)21-10-9-20-15-27(30(42)33-4)40(19(2)3)26(20)16-21/h8-12,15-19H,1,13-14H2,2-7H3,(H,33,42)(H,36,41)(H,34,35,37) |
| InChIKey | GDNREXXKMZOXMO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|